![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| statistical computation.pdf | 2015-05-24 23:04 | 1.5M | |
| A Fast Bilinear Structure from Motion.pdf | 2015-05-24 23:04 | 1.6M | |
| Structured light 3D scanning in the presence of global illumination.pdf | 2015-05-24 23:04 | 2.5M | |
| Coded strobing photography Compressive sensing of high speed periodic videos.pdf | 2015-05-24 23:04 | 3.0M | |
| Progressive versus Random Projections for Compressive Capture of Images,.pdf | 2015-05-24 23:04 | 3.0M | |
| Finding a Needle in a Specular Haystack.pdf | 2015-05-24 23:04 | 3.2M | |
| P2C2 Programmable Pixel Compressive.pdf | 2015-05-24 23:04 | 5.3M | |